rs.mask masks input sub-structure in reaction.
ms.mask masks input sub-structure in molecule.
rs.mask (substructure, mask, reaction, format = 'rsmi', standardize = T, explicitH = F, recursive = F)
ms.mask (substructure, mask, molecule, format = 'smiles', standardize = T, explicitH = F, recursive = F)TRUE (default).TRUE. It is set as FALSE by default.TRUE. Valence is not checked for the mask atom and the final structure.
rs.makeDB
ms.mask('OP(=O)O', '[Cs]', 'O=P(O)(O)OP(=O)(O)OP(=O)(O)OCC3OC(n2cnc1c(ncnc12)N)C(O)C3O')
Run the code above in your browser using DataLab