# NOT RUN {
## get some molecules
sp <- get.smiles.parser()
smiles <- c('CCC', 'CCN', 'CCN(C)(C)', 'c1ccccc1Cc1ccccc1','C1CCC1CC(CN(C)(C))CC(=O)CC')
mols <- parse.smiles(smiles)
## get a single fingerprint using the standard
## (hashed, path based) fingerprinter
fp <- get.fingerprint(mols[[1]])
## get MACCS keys for all the molecules
fps <- lapply(mols, get.fingerprint, type='maccs')
## get Signature fingerprint
## feature, count fingerprinter
fps <- lapply(mols, get.fingerprint, type='signature', fp.mode='raw')
## get Substructure fingerprint for functional group fragments
fps <- lapply(mols, get.fingerprint, type='substructure')
## get Substructure count fingerprint for user defined fragments
mol1 <- parse.smiles("c1ccccc1CCC")[[1]]
smarts <- c("c1ccccc1", "[CX4H3][#6]", "[CX2]#[CX2]")
fps <- get.fingerprint(mol1, type='substructure', fp.mode='count',
    substructure.pattern=smarts)
## get ECFP0 count fingerprints 
mol2 <- parse.smiles("C1=CC=CC(=C1)CCCC2=CC=CC=C2")[[1]]
fps <- get.fingerprint(mol2, type='circular', fp.mode='count', circular.type='ECFP0')
# }
Run the code above in your browser using DataLab