This function checks if a string is a valid SMILES by checking if (R)CDK can parse it. If it cannot be parsed by rcdk FALSE is returned, else TRUE.
is.smiles(x, verbose = TRUE)
character; input SMILES.
logical; print messages during processing to console?
a logical
Egon Willighagen (2015). How to test SMILES strings in Supplementary Information. https://chem-bla-ics.blogspot.nl/2015/10/how-to-test-smiles-strings-in.html
# NOT RUN { # might fail if rcdk is not working properly is.smiles('Clc(c(Cl)c(Cl)c1C(=O)O)c(Cl)c1Cl') is.smiles('Clc(c(Cl)c(Cl)c1C(=O)O)c(Cl)c1ClJ') # }
Run the code above in your browser using DataLab